C12H23NO — CID 82838286
(E)-2-methyl-N-(2-methylpropyl)-3-(oxolan-2-yl)prop-2-en-1-amine (PubChem CID 82838286) has the molecular formula C12H23NO and a molecular weight of 197.32 g/mol. Its IUPAC name is (E)-2-methyl-N-(2-methylpropyl)-3-(oxolan-2-yl)prop-2-en-1-amine.
| Compound Name | (E)-2-methyl-N-(2-methylpropyl)-3-(oxolan-2-yl)prop-2-en-1-amine |
|---|---|
| PubChem CID | 82838286 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | (E)-2-methyl-N-(2-methylpropyl)-3-(oxolan-2-yl)prop-2-en-1-amine |
| SMILES | C/C(=C\C1CCCO1)CNCC(C)C |
| InChI | InChI=1S/C12H23NO/c1-10(2)8-13-9-11(3)7-12-5-4-6-14-12/h7,10,12-13H,4-6,8-9H2,1-3H3/b11-7+ |
| InChIKey | XLFVSLQZJLDXTP-YRNVUSSQSA-N |
| XLogP | 2.36 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|