C10H22N2O4S2 — CID 82838664
N-[1-(aminomethyl)cyclohexyl]-N-methyl-1-methylsulfonylmethanesulfonamide (PubChem CID 82838664) has the molecular formula C10H22N2O4S2 and a molecular weight of 298.43 g/mol. Its IUPAC name is N-[1-(aminomethyl)cyclohexyl]-N-methyl-1-methylsulfonylmethanesulfonamide.
| Compound Name | N-[1-(aminomethyl)cyclohexyl]-N-methyl-1-methylsulfonylmethanesulfonamide |
|---|---|
| PubChem CID | 82838664 |
| Molecular Formula | C10H22N2O4S2 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | N-[1-(aminomethyl)cyclohexyl]-N-methyl-1-methylsulfonylmethanesulfonamide |
| SMILES | CN(C1(CN)CCCCC1)S(=O)(=O)CS(C)(=O)=O |
| InChI | InChI=1S/C10H22N2O4S2/c1-12(18(15,16)9-17(2,13)14)10(8-11)6-4-3-5-7-10/h3-9,11H2,1-2H3 |
| InChIKey | QGVRGKHWSPGYAP-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |