C9H10ClNO6S2 — CID 82839718
3-chloro-5-(methylsulfonylmethylsulfonylamino)benzoic acid (PubChem CID 82839718) has the molecular formula C9H10ClNO6S2 and a molecular weight of 327.77 g/mol. Its IUPAC name is 3-chloro-5-(methylsulfonylmethylsulfonylamino)benzoic acid.
| Compound Name | 3-chloro-5-(methylsulfonylmethylsulfonylamino)benzoic acid |
|---|---|
| PubChem CID | 82839718 |
| Molecular Formula | C9H10ClNO6S2 |
| Molecular Weight | 327.77 g/mol |
| Exact Mass | 326.96 |
| IUPAC Name | 3-chloro-5-(methylsulfonylmethylsulfonylamino)benzoic acid |
| SMILES | CS(=O)(=O)CS(=O)(=O)Nc1cc(Cl)cc(C(=O)O)c1 |
| InChI | InChI=1S/C9H10ClNO6S2/c1-18(14,15)5-19(16,17)11-8-3-6(9(12)13)2-7(10)4-8/h2-4,11H,5H2,1H3,(H,12,13) |
| InChIKey | LKTDTMYNWUCFQN-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 117.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.77 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |