C13H15Cl2N3S — CID 82841050
2,6-dichloro-4-[[1-(1,3-thiazol-2-yl)propylamino]methyl]aniline (PubChem CID 82841050) has the molecular formula C13H15Cl2N3S and a molecular weight of 316.26 g/mol. Its IUPAC name is 2,6-dichloro-4-[[1-(1,3-thiazol-2-yl)propylamino]methyl]aniline.
| Compound Name | 2,6-dichloro-4-[[1-(1,3-thiazol-2-yl)propylamino]methyl]aniline |
|---|---|
| PubChem CID | 82841050 |
| Molecular Formula | C13H15Cl2N3S |
| Molecular Weight | 316.26 g/mol |
| Exact Mass | 315.04 |
| IUPAC Name | 2,6-dichloro-4-[[1-(1,3-thiazol-2-yl)propylamino]methyl]aniline |
| SMILES | CCC(NCc1cc(Cl)c(N)c(Cl)c1)c1nccs1 |
| InChI | InChI=1S/C13H15Cl2N3S/c1-2-11(13-17-3-4-19-13)18-7-8-5-9(14)12(16)10(15)6-8/h3-6,11,18H,2,7,16H2,1H3 |
| InChIKey | MWLXWKFPOXAOTP-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.26 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|