C14H16Cl2N2S — CID 82841766
2,6-dichloro-4-[[(3-ethylthiophen-2-yl)methylamino]methyl]aniline (PubChem CID 82841766) has the molecular formula C14H16Cl2N2S and a molecular weight of 315.27 g/mol. Its IUPAC name is 2,6-dichloro-4-[[(3-ethylthiophen-2-yl)methylamino]methyl]aniline.
| Compound Name | 2,6-dichloro-4-[[(3-ethylthiophen-2-yl)methylamino]methyl]aniline |
|---|---|
| PubChem CID | 82841766 |
| Molecular Formula | C14H16Cl2N2S |
| Molecular Weight | 315.27 g/mol |
| Exact Mass | 314.04 |
| IUPAC Name | 2,6-dichloro-4-[[(3-ethylthiophen-2-yl)methylamino]methyl]aniline |
| SMILES | CCc1ccsc1CNCc1cc(Cl)c(N)c(Cl)c1 |
| InChI | InChI=1S/C14H16Cl2N2S/c1-2-10-3-4-19-13(10)8-18-7-9-5-11(15)14(17)12(16)6-9/h3-6,18H,2,7-8,17H2,1H3 |
| InChIKey | ZHCHIAVPOKCRHA-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.27 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|