C17H25NSSi — CID 103437925
N-[(3-ethylthiophen-2-yl)methyl]-1-(4-trimethylsilylphenyl)methanamine (PubChem CID 103437925) has the molecular formula C17H25NSSi and a molecular weight of 303.55 g/mol. Its IUPAC name is N-[(3-ethylthiophen-2-yl)methyl]-1-(4-trimethylsilylphenyl)methanamine.
| Compound Name | N-[(3-ethylthiophen-2-yl)methyl]-1-(4-trimethylsilylphenyl)methanamine |
|---|---|
| PubChem CID | 103437925 |
| Molecular Formula | C17H25NSSi |
| Molecular Weight | 303.55 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | N-[(3-ethylthiophen-2-yl)methyl]-1-(4-trimethylsilylphenyl)methanamine |
| SMILES | CCc1ccsc1CNCc1ccc([Si](C)(C)C)cc1 |
| InChI | InChI=1S/C17H25NSSi/c1-5-15-10-11-19-17(15)13-18-12-14-6-8-16(9-7-14)20(2,3)4/h6-11,18H,5,12-13H2,1-4H3 |
| InChIKey | XMOJLHGAFFAUQA-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.55 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|