C17H23NS — CID 114333451
N-[(3-ethylthiophen-2-yl)methyl]-4-phenylbutan-1-amine (PubChem CID 114333451) has the molecular formula C17H23NS and a molecular weight of 273.44 g/mol. Its IUPAC name is N-[(3-ethylthiophen-2-yl)methyl]-4-phenylbutan-1-amine.
| Compound Name | N-[(3-ethylthiophen-2-yl)methyl]-4-phenylbutan-1-amine |
|---|---|
| PubChem CID | 114333451 |
| Molecular Formula | C17H23NS |
| Molecular Weight | 273.44 g/mol |
| Exact Mass | 273.16 |
| IUPAC Name | N-[(3-ethylthiophen-2-yl)methyl]-4-phenylbutan-1-amine |
| SMILES | CCc1ccsc1CNCCCCc1ccccc1 |
| InChI | InChI=1S/C17H23NS/c1-2-16-11-13-19-17(16)14-18-12-7-6-10-15-8-4-3-5-9-15/h3-5,8-9,11,13,18H,2,6-7,10,12,14H2,1H3 |
| InChIKey | FIKXSVJFOGUDJE-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.44 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|