C15H26N2S — CID 113411481
N-[(3-ethylthiophen-2-yl)methyl]-3-piperidin-1-ylpropan-1-amine (PubChem CID 113411481) has the molecular formula C15H26N2S and a molecular weight of 266.45 g/mol. Its IUPAC name is N-[(3-ethylthiophen-2-yl)methyl]-3-piperidin-1-ylpropan-1-amine.
| Compound Name | N-[(3-ethylthiophen-2-yl)methyl]-3-piperidin-1-ylpropan-1-amine |
|---|---|
| PubChem CID | 113411481 |
| Molecular Formula | C15H26N2S |
| Molecular Weight | 266.45 g/mol |
| Exact Mass | 266.18 |
| IUPAC Name | N-[(3-ethylthiophen-2-yl)methyl]-3-piperidin-1-ylpropan-1-amine |
| SMILES | CCc1ccsc1CNCCCN1CCCCC1 |
| InChI | InChI=1S/C15H26N2S/c1-2-14-7-12-18-15(14)13-16-8-6-11-17-9-4-3-5-10-17/h7,12,16H,2-6,8-11,13H2,1H3 |
| InChIKey | IQSRPZVJGMYZJB-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.45 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|