C19H30S — CID 159721610
2,3-diethylthiophene;ethylbenzene;propane (PubChem CID 159721610) has the molecular formula C19H30S and a molecular weight of 290.52 g/mol. Its IUPAC name is 2,3-diethylthiophene;ethylbenzene;propane.
| Compound Name | 2,3-diethylthiophene;ethylbenzene;propane |
|---|---|
| PubChem CID | 159721610 |
| Molecular Formula | C19H30S |
| Molecular Weight | 290.52 g/mol |
| Exact Mass | 290.21 |
| IUPAC Name | 2,3-diethylthiophene;ethylbenzene;propane |
| SMILES | CCC.CCc1ccccc1.CCc1ccsc1CC |
| InChI | InChI=1S/C8H12S.C8H10.C3H8/c1-3-7-5-6-9-8(7)4-2;1-2-8-6-4-3-5-7-8;1-3-2/h5-6H,3-4H2,1-2H3;3-7H,2H2,1H3;3H2,1-2H3 |
| InChIKey | NACNJZHBARFING-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.52 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |