C12H19F3N2O3 — CID 82848088
5-[[cyclopropyl(2,2,2-trifluoroethyl)carbamoyl]amino]hexanoic acid (PubChem CID 82848088) has the molecular formula C12H19F3N2O3 and a molecular weight of 296.29 g/mol. Its IUPAC name is 5-[[cyclopropyl(2,2,2-trifluoroethyl)carbamoyl]amino]hexanoic acid.
| Compound Name | 5-[[cyclopropyl(2,2,2-trifluoroethyl)carbamoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 82848088 |
| Molecular Formula | C12H19F3N2O3 |
| Molecular Weight | 296.29 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | 5-[[cyclopropyl(2,2,2-trifluoroethyl)carbamoyl]amino]hexanoic acid |
| SMILES | CC(CCCC(=O)O)NC(=O)N(CC(F)(F)F)C1CC1 |
| InChI | InChI=1S/C12H19F3N2O3/c1-8(3-2-4-10(18)19)16-11(20)17(9-5-6-9)7-12(13,14)15/h8-9H,2-7H2,1H3,(H,16,20)(H,18,19) |
| InChIKey | QEAAIAWGEDOTJN-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.29 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |