C12H17IN2O — CID 82848467
5-amino-N-(2-iodophenyl)hexanamide (PubChem CID 82848467) has the molecular formula C12H17IN2O and a molecular weight of 332.19 g/mol. Its IUPAC name is 5-amino-N-(2-iodophenyl)hexanamide.
| Compound Name | 5-amino-N-(2-iodophenyl)hexanamide |
|---|---|
| PubChem CID | 82848467 |
| Molecular Formula | C12H17IN2O |
| Molecular Weight | 332.19 g/mol |
| Exact Mass | 332.04 |
| IUPAC Name | 5-amino-N-(2-iodophenyl)hexanamide |
| SMILES | CC(N)CCCC(=O)Nc1ccccc1I |
| InChI | InChI=1S/C12H17IN2O/c1-9(14)5-4-8-12(16)15-11-7-3-2-6-10(11)13/h2-3,6-7,9H,4-5,8,14H2,1H3,(H,15,16) |
| InChIKey | KJRDNPNXKYNNAP-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.19 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|