C10H15NO3S — CID 82849724
3-(4-amino-2-methoxyphenyl)sulfanylpropane-1,2-diol (PubChem CID 82849724) has the molecular formula C10H15NO3S and a molecular weight of 229.30 g/mol. Its IUPAC name is 3-(4-amino-2-methoxyphenyl)sulfanylpropane-1,2-diol.
| Compound Name | 3-(4-amino-2-methoxyphenyl)sulfanylpropane-1,2-diol |
|---|---|
| PubChem CID | 82849724 |
| Molecular Formula | C10H15NO3S |
| Molecular Weight | 229.30 g/mol |
| Exact Mass | 229.08 |
| IUPAC Name | 3-(4-amino-2-methoxyphenyl)sulfanylpropane-1,2-diol |
| SMILES | COc1cc(N)ccc1SCC(O)CO |
| InChI | InChI=1S/C10H15NO3S/c1-14-9-4-7(11)2-3-10(9)15-6-8(13)5-12/h2-4,8,12-13H,5-6,11H2,1H3 |
| InChIKey | VSJLIQJNOONGNA-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.30 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|