C15H23N3S — CID 82855362
N-cyclopropyl-1-(4,5-dimethyl-1,3-thiazol-2-yl)-2,3,5,6,7,8-hexahydropyrrolizin-1-amine (PubChem CID 82855362) has the molecular formula C15H23N3S and a molecular weight of 277.44 g/mol. Its IUPAC name is N-cyclopropyl-1-(4,5-dimethyl-1,3-thiazol-2-yl)-2,3,5,6,7,8-hexahydropyrrolizin-1-amine.
| Compound Name | N-cyclopropyl-1-(4,5-dimethyl-1,3-thiazol-2-yl)-2,3,5,6,7,8-hexahydropyrrolizin-1-amine |
|---|---|
| PubChem CID | 82855362 |
| Molecular Formula | C15H23N3S |
| Molecular Weight | 277.44 g/mol |
| Exact Mass | 277.16 |
| IUPAC Name | N-cyclopropyl-1-(4,5-dimethyl-1,3-thiazol-2-yl)-2,3,5,6,7,8-hexahydropyrrolizin-1-amine |
| SMILES | Cc1nc(C2(NC3CC3)CCN3CCCC32)sc1C |
| InChI | InChI=1S/C15H23N3S/c1-10-11(2)19-14(16-10)15(17-12-5-6-12)7-9-18-8-3-4-13(15)18/h12-13,17H,3-9H2,1-2H3 |
| InChIKey | HOGKBDPFLJEZAI-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.44 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |