C11H17N3S — CID 82856477
N-methyl-1-(1,3-thiazol-2-yl)-2,3,5,6,7,8-hexahydropyrrolizin-1-amine (PubChem CID 82856477) has the molecular formula C11H17N3S and a molecular weight of 223.34 g/mol. Its IUPAC name is N-methyl-1-(1,3-thiazol-2-yl)-2,3,5,6,7,8-hexahydropyrrolizin-1-amine.
| Compound Name | N-methyl-1-(1,3-thiazol-2-yl)-2,3,5,6,7,8-hexahydropyrrolizin-1-amine |
|---|---|
| PubChem CID | 82856477 |
| Molecular Formula | C11H17N3S |
| Molecular Weight | 223.34 g/mol |
| Exact Mass | 223.11 |
| IUPAC Name | N-methyl-1-(1,3-thiazol-2-yl)-2,3,5,6,7,8-hexahydropyrrolizin-1-amine |
| SMILES | CNC1(c2nccs2)CCN2CCCC21 |
| InChI | InChI=1S/C11H17N3S/c1-12-11(10-13-5-8-15-10)4-7-14-6-2-3-9(11)14/h5,8-9,12H,2-4,6-7H2,1H3 |
| InChIKey | IZSSUNIUHVUENA-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.34 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |