C15H24N2O4 — CID 82856116
2-methyl-4-oxo-4-(6-oxo-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-2-yl)-2-propan-2-ylbutanoic acid (PubChem CID 82856116) has the molecular formula C15H24N2O4 and a molecular weight of 296.37 g/mol. Its IUPAC name is 2-methyl-4-oxo-4-(6-oxo-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-2-yl)-2-propan-2-ylbutanoic acid.
| Compound Name | 2-methyl-4-oxo-4-(6-oxo-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-2-yl)-2-propan-2-ylbutanoic acid |
|---|---|
| PubChem CID | 82856116 |
| Molecular Formula | C15H24N2O4 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | 2-methyl-4-oxo-4-(6-oxo-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-2-yl)-2-propan-2-ylbutanoic acid |
| SMILES | CC(C)C(C)(CC(=O)N1CCN2C(=O)CCC2C1)C(=O)O |
| InChI | InChI=1S/C15H24N2O4/c1-10(2)15(3,14(20)21)8-13(19)16-6-7-17-11(9-16)4-5-12(17)18/h10-11H,4-9H2,1-3H3,(H,20,21) |
| InChIKey | CBRHQNLMDKULAV-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |