C16H20N2O2S — CID 82858584
2-[[5-(4-hydroxybut-1-ynyl)thiophen-2-yl]methyl]-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-6-one (PubChem CID 82858584) has the molecular formula C16H20N2O2S and a molecular weight of 304.42 g/mol. Its IUPAC name is 2-[[5-(4-hydroxybut-1-ynyl)thiophen-2-yl]methyl]-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-6-one.
| Compound Name | 2-[[5-(4-hydroxybut-1-ynyl)thiophen-2-yl]methyl]-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-6-one |
|---|---|
| PubChem CID | 82858584 |
| Molecular Formula | C16H20N2O2S |
| Molecular Weight | 304.42 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | 2-[[5-(4-hydroxybut-1-ynyl)thiophen-2-yl]methyl]-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-6-one |
| SMILES | O=C1CCC2CN(Cc3ccc(C#CCCO)s3)CCN12 |
| InChI | InChI=1S/C16H20N2O2S/c19-10-2-1-3-14-5-6-15(21-14)12-17-8-9-18-13(11-17)4-7-16(18)20/h5-6,13,19H,2,4,7-12H2 |
| InChIKey | NAYRDIWHLBQRNA-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.42 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|