C12H14N4O — CID 828601
1-(5-amino-3-phenyl-1,2,4-triazol-1-yl)butan-1-one (PubChem CID 828601) has the molecular formula C12H14N4O and a molecular weight of 230.27 g/mol. Its IUPAC name is 1-(5-amino-3-phenyl-1,2,4-triazol-1-yl)butan-1-one.
| Compound Name | 1-(5-amino-3-phenyl-1,2,4-triazol-1-yl)butan-1-one |
|---|---|
| PubChem CID | 828601 |
| Molecular Formula | C12H14N4O |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | 1-(5-amino-3-phenyl-1,2,4-triazol-1-yl)butan-1-one |
| SMILES | CCCC(=O)n1nc(-c2ccccc2)nc1N |
| InChI | InChI=1S/C12H14N4O/c1-2-6-10(17)16-12(13)14-11(15-16)9-7-4-3-5-8-9/h3-5,7-8H,2,6H2,1H3,(H2,13,14,15) |
| InChIKey | BZLRZNISTORZEP-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |