C14H16BrN3O3 — CID 82860183
3-bromo-N-[(4,6-dimethoxypyrimidin-5-yl)methyl]-5-methoxyaniline (PubChem CID 82860183) has the molecular formula C14H16BrN3O3 and a molecular weight of 354.20 g/mol. Its IUPAC name is 3-bromo-N-[(4,6-dimethoxypyrimidin-5-yl)methyl]-5-methoxyaniline.
| Compound Name | 3-bromo-N-[(4,6-dimethoxypyrimidin-5-yl)methyl]-5-methoxyaniline |
|---|---|
| PubChem CID | 82860183 |
| Molecular Formula | C14H16BrN3O3 |
| Molecular Weight | 354.20 g/mol |
| Exact Mass | 353.04 |
| IUPAC Name | 3-bromo-N-[(4,6-dimethoxypyrimidin-5-yl)methyl]-5-methoxyaniline |
| SMILES | COc1cc(Br)cc(NCc2c(OC)ncnc2OC)c1 |
| InChI | InChI=1S/C14H16BrN3O3/c1-19-11-5-9(15)4-10(6-11)16-7-12-13(20-2)17-8-18-14(12)21-3/h4-6,8,16H,7H2,1-3H3 |
| InChIKey | VCONSMKAFMVYSY-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 65.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.20 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |