C14H23BrN2O2 — CID 82863180
2-[[4-(bromomethyl)oxan-4-yl]methyl]-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-6-one (PubChem CID 82863180) has the molecular formula C14H23BrN2O2 and a molecular weight of 331.25 g/mol. Its IUPAC name is 2-[[4-(bromomethyl)oxan-4-yl]methyl]-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-6-one.
| Compound Name | 2-[[4-(bromomethyl)oxan-4-yl]methyl]-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-6-one |
|---|---|
| PubChem CID | 82863180 |
| Molecular Formula | C14H23BrN2O2 |
| Molecular Weight | 331.25 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | 2-[[4-(bromomethyl)oxan-4-yl]methyl]-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-6-one |
| SMILES | O=C1CCC2CN(CC3(CBr)CCOCC3)CCN12 |
| InChI | InChI=1S/C14H23BrN2O2/c15-10-14(3-7-19-8-4-14)11-16-5-6-17-12(9-16)1-2-13(17)18/h12H,1-11H2 |
| InChIKey | QPKMMTJZZMSWPX-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.25 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|