C13H19N3 — CID 82870674
4-methyl-1-[(1-methylpyrazol-3-yl)methyl]cyclohexane-1-carbonitrile (PubChem CID 82870674) has the molecular formula C13H19N3 and a molecular weight of 217.32 g/mol. Its IUPAC name is 4-methyl-1-[(1-methylpyrazol-3-yl)methyl]cyclohexane-1-carbonitrile.
| Compound Name | 4-methyl-1-[(1-methylpyrazol-3-yl)methyl]cyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 82870674 |
| Molecular Formula | C13H19N3 |
| Molecular Weight | 217.32 g/mol |
| Exact Mass | 217.16 |
| IUPAC Name | 4-methyl-1-[(1-methylpyrazol-3-yl)methyl]cyclohexane-1-carbonitrile |
| SMILES | CC1CCC(C#N)(Cc2ccn(C)n2)CC1 |
| InChI | InChI=1S/C13H19N3/c1-11-3-6-13(10-14,7-4-11)9-12-5-8-16(2)15-12/h5,8,11H,3-4,6-7,9H2,1-2H3 |
| InChIKey | MVRYTXOIQHEHTA-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 41.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.32 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |