C15H18N4O2 — CID 82873099
2-[2-hydroxy-3-[(1-methylpyrazol-3-yl)methylamino]propoxy]benzonitrile (PubChem CID 82873099) has the molecular formula C15H18N4O2 and a molecular weight of 286.33 g/mol. Its IUPAC name is 2-[2-hydroxy-3-[(1-methylpyrazol-3-yl)methylamino]propoxy]benzonitrile.
| Compound Name | 2-[2-hydroxy-3-[(1-methylpyrazol-3-yl)methylamino]propoxy]benzonitrile |
|---|---|
| PubChem CID | 82873099 |
| Molecular Formula | C15H18N4O2 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | 2-[2-hydroxy-3-[(1-methylpyrazol-3-yl)methylamino]propoxy]benzonitrile |
| SMILES | Cn1ccc(CNCC(O)COc2ccccc2C#N)n1 |
| InChI | InChI=1S/C15H18N4O2/c1-19-7-6-13(18-19)9-17-10-14(20)11-21-15-5-3-2-4-12(15)8-16/h2-7,14,17,20H,9-11H2,1H3 |
| InChIKey | CVPQSBSRYUCCFR-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 83.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |