C11H11N5 — CID 82873499
6-[(1-methylpyrazol-3-yl)methylamino]pyridine-3-carbonitrile (PubChem CID 82873499) has the molecular formula C11H11N5 and a molecular weight of 213.24 g/mol. Its IUPAC name is 6-[(1-methylpyrazol-3-yl)methylamino]pyridine-3-carbonitrile.
| Compound Name | 6-[(1-methylpyrazol-3-yl)methylamino]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 82873499 |
| Molecular Formula | C11H11N5 |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | 6-[(1-methylpyrazol-3-yl)methylamino]pyridine-3-carbonitrile |
| SMILES | Cn1ccc(CNc2ccc(C#N)cn2)n1 |
| InChI | InChI=1S/C11H11N5/c1-16-5-4-10(15-16)8-14-11-3-2-9(6-12)7-13-11/h2-5,7H,8H2,1H3,(H,13,14) |
| InChIKey | RBECUTPITGOJRW-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 66.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |