C13H16N4S — CID 82873759
2-methyl-4-[(1-methylpyrazol-3-yl)methylamino]benzenecarbothioamide (PubChem CID 82873759) has the molecular formula C13H16N4S and a molecular weight of 260.37 g/mol. Its IUPAC name is 2-methyl-4-[(1-methylpyrazol-3-yl)methylamino]benzenecarbothioamide.
| Compound Name | 2-methyl-4-[(1-methylpyrazol-3-yl)methylamino]benzenecarbothioamide |
|---|---|
| PubChem CID | 82873759 |
| Molecular Formula | C13H16N4S |
| Molecular Weight | 260.37 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | 2-methyl-4-[(1-methylpyrazol-3-yl)methylamino]benzenecarbothioamide |
| SMILES | Cc1cc(NCc2ccn(C)n2)ccc1C(N)=S |
| InChI | InChI=1S/C13H16N4S/c1-9-7-10(3-4-12(9)13(14)18)15-8-11-5-6-17(2)16-11/h3-7,15H,8H2,1-2H3,(H2,14,18) |
| InChIKey | YNQCYMUVQNCAPD-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.37 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|