C15H22ClNO3S — CID 82879574
[5-chloro-2-methyl-3-(2-propan-2-ylpyrrolidin-1-yl)sulfonylphenyl]methanol (PubChem CID 82879574) has the molecular formula C15H22ClNO3S and a molecular weight of 331.87 g/mol. Its IUPAC name is [5-chloro-2-methyl-3-(2-propan-2-ylpyrrolidin-1-yl)sulfonylphenyl]methanol.
| Compound Name | [5-chloro-2-methyl-3-(2-propan-2-ylpyrrolidin-1-yl)sulfonylphenyl]methanol |
|---|---|
| PubChem CID | 82879574 |
| Molecular Formula | C15H22ClNO3S |
| Molecular Weight | 331.87 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | [5-chloro-2-methyl-3-(2-propan-2-ylpyrrolidin-1-yl)sulfonylphenyl]methanol |
| SMILES | Cc1c(CO)cc(Cl)cc1S(=O)(=O)N1CCCC1C(C)C |
| InChI | InChI=1S/C15H22ClNO3S/c1-10(2)14-5-4-6-17(14)21(19,20)15-8-13(16)7-12(9-18)11(15)3/h7-8,10,14,18H,4-6,9H2,1-3H3 |
| InChIKey | TYNWAYUXNBGIIX-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.87 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |