About [5-chloro-3-(2,6-dimethylthiomorpholin-4-yl)sulfonyl-2-methylphenyl]methanol
[5-chloro-3-(2,6-dimethylthiomorpholin-4-yl)sulfonyl-2-methylphenyl]methanol (PubChem CID 82880059) has the molecular formula C14H20ClNO3S2
and a molecular weight of 349.91 g/mol. Its IUPAC name is [5-chloro-3-(2,6-dimethylthiomorpholin-4-yl)sulfonyl-2-methylphenyl]methanol.
Molecular Properties
| Compound Name | [5-chloro-3-(2,6-dimethylthiomorpholin-4-yl)sulfonyl-2-methylphenyl]methanol |
| PubChem CID | 82880059 |
| Molecular Formula | C14H20ClNO3S2 |
| Molecular Weight | 349.91 g/mol |
| Exact Mass | 349.06 |
| IUPAC Name | [5-chloro-3-(2,6-dimethylthiomorpholin-4-yl)sulfonyl-2-methylphenyl]methanol |
| SMILES | Cc1c(CO)cc(Cl)cc1S(=O)(=O)N1CC(C)SC(C)C1 |
| InChI | InChI=1S/C14H20ClNO3S2/c1-9-6-16(7-10(2)20-9)21(18,19)14-5-13(15)4-12(8-17)11(14)3/h4-5,9-10,17H,6-8H2,1-3H3 |
| InChIKey | ROPACSZBSJTAKS-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.91 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [5-chloro-3-(2,6-dimethylthiomorpholin-4-yl)sulfonyl-2-methylphenyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-chloro-3-(2,6-dimethylthiomorpholin-4-yl)sulfonyl-2-methylphenyl]methanol?
The IUPAC name of [5-chloro-3-(2,6-dimethylthiomorpholin-4-yl)sulfonyl-2-methylphenyl]methanol (CID 82880059) is [5-chloro-3-(2,6-dimethylthiomorpholin-4-yl)sulfonyl-2-methylphenyl]methanol.
What is the SMILES notation for [5-chloro-3-(2,6-dimethylthiomorpholin-4-yl)sulfonyl-2-methylphenyl]methanol?
The canonical SMILES for [5-chloro-3-(2,6-dimethylthiomorpholin-4-yl)sulfonyl-2-methylphenyl]methanol is Cc1c(CO)cc(Cl)cc1S(=O)(=O)N1CC(C)SC(C)C1.
What is the InChIKey of [5-chloro-3-(2,6-dimethylthiomorpholin-4-yl)sulfonyl-2-methylphenyl]methanol?
The InChIKey is ROPACSZBSJTAKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20ClNO3S2/c1-9-6-16(7-10(2)20-9)21(18,19)14-5-13(15)4-12(8-17)11(14)3/h4-5,9-10,17H,6-8H2,1-3H3.
What are the key properties of [5-chloro-3-(2,6-dimethylthiomorpholin-4-yl)sulfonyl-2-methylphenyl]methanol?
[5-chloro-3-(2,6-dimethylthiomorpholin-4-yl)sulfonyl-2-methylphenyl]methanol has a molecular weight of 349.91 g/mol, XLogP of 2.66, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [5-chloro-3-(2,6-dimethylthiomorpholin-4-yl)sulfonyl-2-methylphenyl]methanol is sourced from PubChem (CID 82880059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).