C10H12N4S — CID 82879754
1-(1,3-thiazol-2-yl)-4,5,6,7-tetrahydroindazol-4-amine (PubChem CID 82879754) has the molecular formula C10H12N4S and a molecular weight of 220.30 g/mol. Its IUPAC name is 1-(1,3-thiazol-2-yl)-4,5,6,7-tetrahydroindazol-4-amine.
| Compound Name | 1-(1,3-thiazol-2-yl)-4,5,6,7-tetrahydroindazol-4-amine |
|---|---|
| PubChem CID | 82879754 |
| Molecular Formula | C10H12N4S |
| Molecular Weight | 220.30 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | 1-(1,3-thiazol-2-yl)-4,5,6,7-tetrahydroindazol-4-amine |
| SMILES | NC1CCCc2c1cnn2-c1nccs1 |
| InChI | InChI=1S/C10H12N4S/c11-8-2-1-3-9-7(8)6-13-14(9)10-12-4-5-15-10/h4-6,8H,1-3,11H2 |
| InChIKey | SRVBIXLCQNVVLF-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.30 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |