C13H19NOS — CID 82887708
6-methoxy-N-propyl-3,4-dihydro-1H-isothiochromen-4-amine (PubChem CID 82887708) has the molecular formula C13H19NOS and a molecular weight of 237.37 g/mol. Its IUPAC name is 6-methoxy-N-propyl-3,4-dihydro-1H-isothiochromen-4-amine.
| Compound Name | 6-methoxy-N-propyl-3,4-dihydro-1H-isothiochromen-4-amine |
|---|---|
| PubChem CID | 82887708 |
| Molecular Formula | C13H19NOS |
| Molecular Weight | 237.37 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | 6-methoxy-N-propyl-3,4-dihydro-1H-isothiochromen-4-amine |
| SMILES | CCCNC1CSCc2ccc(OC)cc21 |
| InChI | InChI=1S/C13H19NOS/c1-3-6-14-13-9-16-8-10-4-5-11(15-2)7-12(10)13/h4-5,7,13-14H,3,6,8-9H2,1-2H3 |
| InChIKey | SFLOGIURCCQQGK-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.37 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |