C11H22F3N3O — CID 82889118
2-(4-methylpiperazin-1-yl)-N-[2-(2,2,2-trifluoroethoxy)ethyl]ethanamine (PubChem CID 82889118) has the molecular formula C11H22F3N3O and a molecular weight of 269.31 g/mol. Its IUPAC name is 2-(4-methylpiperazin-1-yl)-N-[2-(2,2,2-trifluoroethoxy)ethyl]ethanamine.
| Compound Name | 2-(4-methylpiperazin-1-yl)-N-[2-(2,2,2-trifluoroethoxy)ethyl]ethanamine |
|---|---|
| PubChem CID | 82889118 |
| Molecular Formula | C11H22F3N3O |
| Molecular Weight | 269.31 g/mol |
| Exact Mass | 269.17 |
| IUPAC Name | 2-(4-methylpiperazin-1-yl)-N-[2-(2,2,2-trifluoroethoxy)ethyl]ethanamine |
| SMILES | CN1CCN(CCNCCOCC(F)(F)F)CC1 |
| InChI | InChI=1S/C11H22F3N3O/c1-16-5-7-17(8-6-16)4-2-15-3-9-18-10-11(12,13)14/h15H,2-10H2,1H3 |
| InChIKey | JAALSYXXILLPKW-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.31 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|