C12H30N4 — CID 171070522
ethane;N-methyl-N'-[2-(4-methylpiperazin-1-yl)ethyl]ethane-1,2-diamine (PubChem CID 171070522) has the molecular formula C12H30N4 and a molecular weight of 230.40 g/mol. Its IUPAC name is ethane;N-methyl-N'-[2-(4-methylpiperazin-1-yl)ethyl]ethane-1,2-diamine.
| Compound Name | ethane;N-methyl-N'-[2-(4-methylpiperazin-1-yl)ethyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 171070522 |
| Molecular Formula | C12H30N4 |
| Molecular Weight | 230.40 g/mol |
| Exact Mass | 230.25 |
| IUPAC Name | ethane;N-methyl-N'-[2-(4-methylpiperazin-1-yl)ethyl]ethane-1,2-diamine |
| SMILES | CC.CNCCNCCN1CCN(C)CC1 |
| InChI | InChI=1S/C10H24N4.C2H6/c1-11-3-4-12-5-6-14-9-7-13(2)8-10-14;1-2/h11-12H,3-10H2,1-2H3;1-2H3 |
| InChIKey | SXIJZTLSAUOEAI-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.40 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|