C13H31N5 — CID 130246433
N'-[2-[4-[2-(dimethylamino)ethyl]piperazin-1-yl]ethyl]-N-methylethane-1,2-diamine (PubChem CID 130246433) has the molecular formula C13H31N5 and a molecular weight of 257.43 g/mol. Its IUPAC name is N'-[2-[4-[2-(dimethylamino)ethyl]piperazin-1-yl]ethyl]-N-methylethane-1,2-diamine.
| Compound Name | N'-[2-[4-[2-(dimethylamino)ethyl]piperazin-1-yl]ethyl]-N-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 130246433 |
| Molecular Formula | C13H31N5 |
| Molecular Weight | 257.43 g/mol |
| Exact Mass | 257.26 |
| IUPAC Name | N'-[2-[4-[2-(dimethylamino)ethyl]piperazin-1-yl]ethyl]-N-methylethane-1,2-diamine |
| SMILES | CNCCNCCN1CCN(CCN(C)C)CC1 |
| InChI | InChI=1S/C13H31N5/c1-14-4-5-15-6-7-17-10-12-18(13-11-17)9-8-16(2)3/h14-15H,4-13H2,1-3H3 |
| InChIKey | WZRWCYKYKNKTJA-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 33.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.43 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|