About N'-[2-[4-[2-(dimethylamino)ethyl]piperazin-1-yl]ethyl]-N-methylethane-1,2-diamine
N'-[2-[4-[2-(dimethylamino)ethyl]piperazin-1-yl]ethyl]-N-methylethane-1,2-diamine (PubChem CID 130246433) has the molecular formula C13H31N5
and a molecular weight of 257.43 g/mol. Its IUPAC name is N'-[2-[4-[2-(dimethylamino)ethyl]piperazin-1-yl]ethyl]-N-methylethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-[2-[4-[2-(dimethylamino)ethyl]piperazin-1-yl]ethyl]-N-methylethane-1,2-diamine |
| PubChem CID | 130246433 |
| Molecular Formula | C13H31N5 |
| Molecular Weight | 257.43 g/mol |
| Exact Mass | 257.26 |
| IUPAC Name | N'-[2-[4-[2-(dimethylamino)ethyl]piperazin-1-yl]ethyl]-N-methylethane-1,2-diamine |
| SMILES | CNCCNCCN1CCN(CCN(C)C)CC1 |
| InChI | InChI=1S/C13H31N5/c1-14-4-5-15-6-7-17-10-12-18(13-11-17)9-8-16(2)3/h14-15H,4-13H2,1-3H3 |
| InChIKey | WZRWCYKYKNKTJA-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 33.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.43 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N'-[2-[4-[2-(dimethylamino)ethyl]piperazin-1-yl]ethyl]-N-methylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[2-[4-[2-(dimethylamino)ethyl]piperazin-1-yl]ethyl]-N-methylethane-1,2-diamine?
The IUPAC name of N'-[2-[4-[2-(dimethylamino)ethyl]piperazin-1-yl]ethyl]-N-methylethane-1,2-diamine (CID 130246433) is N'-[2-[4-[2-(dimethylamino)ethyl]piperazin-1-yl]ethyl]-N-methylethane-1,2-diamine.
What is the SMILES notation for N'-[2-[4-[2-(dimethylamino)ethyl]piperazin-1-yl]ethyl]-N-methylethane-1,2-diamine?
The canonical SMILES for N'-[2-[4-[2-(dimethylamino)ethyl]piperazin-1-yl]ethyl]-N-methylethane-1,2-diamine is CNCCNCCN1CCN(CCN(C)C)CC1.
What is the InChIKey of N'-[2-[4-[2-(dimethylamino)ethyl]piperazin-1-yl]ethyl]-N-methylethane-1,2-diamine?
The InChIKey is WZRWCYKYKNKTJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H31N5/c1-14-4-5-15-6-7-17-10-12-18(13-11-17)9-8-16(2)3/h14-15H,4-13H2,1-3H3.
What are the key properties of N'-[2-[4-[2-(dimethylamino)ethyl]piperazin-1-yl]ethyl]-N-methylethane-1,2-diamine?
N'-[2-[4-[2-(dimethylamino)ethyl]piperazin-1-yl]ethyl]-N-methylethane-1,2-diamine has a molecular weight of 257.43 g/mol, XLogP of -1.03, 9 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[2-[4-[2-(dimethylamino)ethyl]piperazin-1-yl]ethyl]-N-methylethane-1,2-diamine is sourced from PubChem (CID 130246433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).