C9H22N4O2S — CID 114384829
2-[2-(4-methylpiperazin-1-yl)ethylamino]ethanesulfonamide (PubChem CID 114384829) has the molecular formula C9H22N4O2S and a molecular weight of 250.37 g/mol. Its IUPAC name is 2-[2-(4-methylpiperazin-1-yl)ethylamino]ethanesulfonamide.
| Compound Name | 2-[2-(4-methylpiperazin-1-yl)ethylamino]ethanesulfonamide |
|---|---|
| PubChem CID | 114384829 |
| Molecular Formula | C9H22N4O2S |
| Molecular Weight | 250.37 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | 2-[2-(4-methylpiperazin-1-yl)ethylamino]ethanesulfonamide |
| SMILES | CN1CCN(CCNCCS(N)(=O)=O)CC1 |
| InChI | InChI=1S/C9H22N4O2S/c1-12-5-7-13(8-6-12)4-2-11-3-9-16(10,14)15/h11H,2-9H2,1H3,(H2,10,14,15) |
| InChIKey | PAOXTSUSBJKORJ-UHFFFAOYSA-N |
| XLogP | -1.89 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.37 |
| LogP ≤ 5 | -1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|