C18H39N3O2S — CID 143648176
2-(4-tert-butylpiperazin-1-yl)-N-[2-(3,3-dimethylbutylsulfonyl)ethyl]ethanamine (PubChem CID 143648176) has the molecular formula C18H39N3O2S and a molecular weight of 361.60 g/mol. Its IUPAC name is 2-(4-tert-butylpiperazin-1-yl)-N-[2-(3,3-dimethylbutylsulfonyl)ethyl]ethanamine.
| Compound Name | 2-(4-tert-butylpiperazin-1-yl)-N-[2-(3,3-dimethylbutylsulfonyl)ethyl]ethanamine |
|---|---|
| PubChem CID | 143648176 |
| Molecular Formula | C18H39N3O2S |
| Molecular Weight | 361.60 g/mol |
| Exact Mass | 361.28 |
| IUPAC Name | 2-(4-tert-butylpiperazin-1-yl)-N-[2-(3,3-dimethylbutylsulfonyl)ethyl]ethanamine |
| SMILES | CC(C)(C)CCS(=O)(=O)CCNCCN1CCN(C(C)(C)C)CC1 |
| InChI | InChI=1S/C18H39N3O2S/c1-17(2,3)7-15-24(22,23)16-9-19-8-10-20-11-13-21(14-12-20)18(4,5)6/h19H,7-16H2,1-6H3 |
| InChIKey | PQNIGFZRKQEEPM-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.60 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|