C12H19N3O2S2 — CID 82900313
4-amino-N,N-dimethyl-3-thiomorpholin-4-ylbenzenesulfonamide (PubChem CID 82900313) has the molecular formula C12H19N3O2S2 and a molecular weight of 301.44 g/mol. Its IUPAC name is 4-amino-N,N-dimethyl-3-thiomorpholin-4-ylbenzenesulfonamide.
| Compound Name | 4-amino-N,N-dimethyl-3-thiomorpholin-4-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 82900313 |
| Molecular Formula | C12H19N3O2S2 |
| Molecular Weight | 301.44 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | 4-amino-N,N-dimethyl-3-thiomorpholin-4-ylbenzenesulfonamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(N)c(N2CCSCC2)c1 |
| InChI | InChI=1S/C12H19N3O2S2/c1-14(2)19(16,17)10-3-4-11(13)12(9-10)15-5-7-18-8-6-15/h3-4,9H,5-8,13H2,1-2H3 |
| InChIKey | WXPGDXJVTMIBMI-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.44 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|