C12H12F2N2O3S — CID 82900784
4-[(2,4-difluorophenyl)carbamoyl]thiomorpholine-3-carboxylic acid (PubChem CID 82900784) has the molecular formula C12H12F2N2O3S and a molecular weight of 302.30 g/mol. Its IUPAC name is 4-[(2,4-difluorophenyl)carbamoyl]thiomorpholine-3-carboxylic acid.
| Compound Name | 4-[(2,4-difluorophenyl)carbamoyl]thiomorpholine-3-carboxylic acid |
|---|---|
| PubChem CID | 82900784 |
| Molecular Formula | C12H12F2N2O3S |
| Molecular Weight | 302.30 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | 4-[(2,4-difluorophenyl)carbamoyl]thiomorpholine-3-carboxylic acid |
| SMILES | O=C(O)C1CSCCN1C(=O)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C12H12F2N2O3S/c13-7-1-2-9(8(14)5-7)15-12(19)16-3-4-20-6-10(16)11(17)18/h1-2,5,10H,3-4,6H2,(H,15,19)(H,17,18) |
| InChIKey | FRSTXVMTVLVILF-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.30 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |