C12H14ClFN2O2S — CID 75437498
N-(2-chloro-4-fluorophenyl)-3-(hydroxymethyl)thiomorpholine-4-carboxamide (PubChem CID 75437498) has the molecular formula C12H14ClFN2O2S and a molecular weight of 304.77 g/mol. Its IUPAC name is N-(2-chloro-4-fluorophenyl)-3-(hydroxymethyl)thiomorpholine-4-carboxamide.
| Compound Name | N-(2-chloro-4-fluorophenyl)-3-(hydroxymethyl)thiomorpholine-4-carboxamide |
|---|---|
| PubChem CID | 75437498 |
| Molecular Formula | C12H14ClFN2O2S |
| Molecular Weight | 304.77 g/mol |
| Exact Mass | 304.04 |
| IUPAC Name | N-(2-chloro-4-fluorophenyl)-3-(hydroxymethyl)thiomorpholine-4-carboxamide |
| SMILES | O=C(Nc1ccc(F)cc1Cl)N1CCSCC1CO |
| InChI | InChI=1S/C12H14ClFN2O2S/c13-10-5-8(14)1-2-11(10)15-12(18)16-3-4-19-7-9(16)6-17/h1-2,5,9,17H,3-4,6-7H2,(H,15,18) |
| InChIKey | DPLOGVHVQIKYFK-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.77 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |