C13H14ClFN2O2S — CID 129381058
N-(2-chloro-4-fluorophenyl)-N'-methyl-N'-[(3S)-thiolan-3-yl]oxamide (PubChem CID 129381058) has the molecular formula C13H14ClFN2O2S and a molecular weight of 316.79 g/mol. Its IUPAC name is N-(2-chloro-4-fluorophenyl)-N'-methyl-N'-[(3S)-thiolan-3-yl]oxamide.
| Compound Name | N-(2-chloro-4-fluorophenyl)-N'-methyl-N'-[(3S)-thiolan-3-yl]oxamide |
|---|---|
| PubChem CID | 129381058 |
| Molecular Formula | C13H14ClFN2O2S |
| Molecular Weight | 316.79 g/mol |
| Exact Mass | 316.04 |
| IUPAC Name | N-(2-chloro-4-fluorophenyl)-N'-methyl-N'-[(3S)-thiolan-3-yl]oxamide |
| SMILES | CN(C(=O)C(=O)Nc1ccc(F)cc1Cl)[C@H]1CCSC1 |
| InChI | InChI=1S/C13H14ClFN2O2S/c1-17(9-4-5-20-7-9)13(19)12(18)16-11-3-2-8(15)6-10(11)14/h2-3,6,9H,4-5,7H2,1H3,(H,16,18)/t9-/m0/s1 |
| InChIKey | OJEAFGLVUDJAFX-VIFPVBQESA-N |
| XLogP | 2.38 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.79 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|