C13H14Cl2N2O3S — CID 66443337
2-[4-[(2,4-dichlorophenyl)carbamoyl]thiomorpholin-3-yl]acetic acid (PubChem CID 66443337) has the molecular formula C13H14Cl2N2O3S and a molecular weight of 349.24 g/mol. Its IUPAC name is 2-[4-[(2,4-dichlorophenyl)carbamoyl]thiomorpholin-3-yl]acetic acid.
| Compound Name | 2-[4-[(2,4-dichlorophenyl)carbamoyl]thiomorpholin-3-yl]acetic acid |
|---|---|
| PubChem CID | 66443337 |
| Molecular Formula | C13H14Cl2N2O3S |
| Molecular Weight | 349.24 g/mol |
| Exact Mass | 348.01 |
| IUPAC Name | 2-[4-[(2,4-dichlorophenyl)carbamoyl]thiomorpholin-3-yl]acetic acid |
| SMILES | O=C(O)CC1CSCCN1C(=O)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H14Cl2N2O3S/c14-8-1-2-11(10(15)5-8)16-13(20)17-3-4-21-7-9(17)6-12(18)19/h1-2,5,9H,3-4,6-7H2,(H,16,20)(H,18,19) |
| InChIKey | JSUZRBVVDNDQOI-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.24 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |