C14H18N2O3S2 — CID 66444509
2-[4-[(3-methylsulfanylphenyl)carbamoyl]thiomorpholin-3-yl]acetic acid (PubChem CID 66444509) has the molecular formula C14H18N2O3S2 and a molecular weight of 326.44 g/mol. Its IUPAC name is 2-[4-[(3-methylsulfanylphenyl)carbamoyl]thiomorpholin-3-yl]acetic acid.
| Compound Name | 2-[4-[(3-methylsulfanylphenyl)carbamoyl]thiomorpholin-3-yl]acetic acid |
|---|---|
| PubChem CID | 66444509 |
| Molecular Formula | C14H18N2O3S2 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | 2-[4-[(3-methylsulfanylphenyl)carbamoyl]thiomorpholin-3-yl]acetic acid |
| SMILES | CSc1cccc(NC(=O)N2CCSCC2CC(=O)O)c1 |
| InChI | InChI=1S/C14H18N2O3S2/c1-20-12-4-2-3-10(7-12)15-14(19)16-5-6-21-9-11(16)8-13(17)18/h2-4,7,11H,5-6,8-9H2,1H3,(H,15,19)(H,17,18) |
| InChIKey | KJRDDMZRDVFWMS-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |