C11H18N2O4S — CID 82904018
4-(4-amino-3-methyloxolane-3-carbonyl)thiomorpholine-3-carboxylic acid (PubChem CID 82904018) has the molecular formula C11H18N2O4S and a molecular weight of 274.34 g/mol. Its IUPAC name is 4-(4-amino-3-methyloxolane-3-carbonyl)thiomorpholine-3-carboxylic acid.
| Compound Name | 4-(4-amino-3-methyloxolane-3-carbonyl)thiomorpholine-3-carboxylic acid |
|---|---|
| PubChem CID | 82904018 |
| Molecular Formula | C11H18N2O4S |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 4-(4-amino-3-methyloxolane-3-carbonyl)thiomorpholine-3-carboxylic acid |
| SMILES | CC1(C(=O)N2CCSCC2C(=O)O)COCC1N |
| InChI | InChI=1S/C11H18N2O4S/c1-11(6-17-4-8(11)12)10(16)13-2-3-18-5-7(13)9(14)15/h7-8H,2-6,12H2,1H3,(H,14,15) |
| InChIKey | PIGSYFJSRRDHGB-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 92.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |