C11H18N2O5S2 — CID 82904143
4-[(1,1-dioxothian-4-yl)carbamoyl]thiomorpholine-3-carboxylic acid (PubChem CID 82904143) has the molecular formula C11H18N2O5S2 and a molecular weight of 322.41 g/mol. Its IUPAC name is 4-[(1,1-dioxothian-4-yl)carbamoyl]thiomorpholine-3-carboxylic acid.
| Compound Name | 4-[(1,1-dioxothian-4-yl)carbamoyl]thiomorpholine-3-carboxylic acid |
|---|---|
| PubChem CID | 82904143 |
| Molecular Formula | C11H18N2O5S2 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.07 |
| IUPAC Name | 4-[(1,1-dioxothian-4-yl)carbamoyl]thiomorpholine-3-carboxylic acid |
| SMILES | O=C(O)C1CSCCN1C(=O)NC1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C11H18N2O5S2/c14-10(15)9-7-19-4-3-13(9)11(16)12-8-1-5-20(17,18)6-2-8/h8-9H,1-7H2,(H,12,16)(H,14,15) |
| InChIKey | YMBDCMBKINGLSC-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |