C13H14Cl2N2O3S — CID 82905746
4-[2-(2,5-dichloroanilino)-2-oxoethyl]thiomorpholine-3-carboxylic acid (PubChem CID 82905746) has the molecular formula C13H14Cl2N2O3S and a molecular weight of 349.24 g/mol. Its IUPAC name is 4-[2-(2,5-dichloroanilino)-2-oxoethyl]thiomorpholine-3-carboxylic acid.
| Compound Name | 4-[2-(2,5-dichloroanilino)-2-oxoethyl]thiomorpholine-3-carboxylic acid |
|---|---|
| PubChem CID | 82905746 |
| Molecular Formula | C13H14Cl2N2O3S |
| Molecular Weight | 349.24 g/mol |
| Exact Mass | 348.01 |
| IUPAC Name | 4-[2-(2,5-dichloroanilino)-2-oxoethyl]thiomorpholine-3-carboxylic acid |
| SMILES | O=C(CN1CCSCC1C(=O)O)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C13H14Cl2N2O3S/c14-8-1-2-9(15)10(5-8)16-12(18)6-17-3-4-21-7-11(17)13(19)20/h1-2,5,11H,3-4,6-7H2,(H,16,18)(H,19,20) |
| InChIKey | CPSUIOSXCRQSTN-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.24 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |