C10H13N5O2S — CID 82907394
4-amino-3-(1H-pyrazol-4-ylmethylamino)benzenesulfonamide (PubChem CID 82907394) has the molecular formula C10H13N5O2S and a molecular weight of 267.31 g/mol. Its IUPAC name is 4-amino-3-(1H-pyrazol-4-ylmethylamino)benzenesulfonamide.
| Compound Name | 4-amino-3-(1H-pyrazol-4-ylmethylamino)benzenesulfonamide |
|---|---|
| PubChem CID | 82907394 |
| Molecular Formula | C10H13N5O2S |
| Molecular Weight | 267.31 g/mol |
| Exact Mass | 267.08 |
| IUPAC Name | 4-amino-3-(1H-pyrazol-4-ylmethylamino)benzenesulfonamide |
| SMILES | Nc1ccc(S(N)(=O)=O)cc1NCc1cn[nH]c1 |
| InChI | InChI=1S/C10H13N5O2S/c11-9-2-1-8(18(12,16)17)3-10(9)13-4-7-5-14-15-6-7/h1-3,5-6,13H,4,11H2,(H,14,15)(H2,12,16,17) |
| InChIKey | LIOKSJPEZBABLQ-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 126.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.31 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|