C12H21N3O2S — CID 82907687
4-amino-3-(4-methylpentan-2-ylamino)benzenesulfonamide (PubChem CID 82907687) has the molecular formula C12H21N3O2S and a molecular weight of 271.39 g/mol. Its IUPAC name is 4-amino-3-(4-methylpentan-2-ylamino)benzenesulfonamide.
| Compound Name | 4-amino-3-(4-methylpentan-2-ylamino)benzenesulfonamide |
|---|---|
| PubChem CID | 82907687 |
| Molecular Formula | C12H21N3O2S |
| Molecular Weight | 271.39 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | 4-amino-3-(4-methylpentan-2-ylamino)benzenesulfonamide |
| SMILES | CC(C)CC(C)Nc1cc(S(N)(=O)=O)ccc1N |
| InChI | InChI=1S/C12H21N3O2S/c1-8(2)6-9(3)15-12-7-10(18(14,16)17)4-5-11(12)13/h4-5,7-9,15H,6,13H2,1-3H3,(H2,14,16,17) |
| InChIKey | JNJUESGOTHHRMV-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.39 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|