C12H19BrN2 — CID 65343468
4-bromo-2-N-(4-methylpentan-2-yl)benzene-1,2-diamine (PubChem CID 65343468) has the molecular formula C12H19BrN2 and a molecular weight of 271.20 g/mol. Its IUPAC name is 4-bromo-2-N-(4-methylpentan-2-yl)benzene-1,2-diamine.
| Compound Name | 4-bromo-2-N-(4-methylpentan-2-yl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 65343468 |
| Molecular Formula | C12H19BrN2 |
| Molecular Weight | 271.20 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | 4-bromo-2-N-(4-methylpentan-2-yl)benzene-1,2-diamine |
| SMILES | CC(C)CC(C)Nc1cc(Br)ccc1N |
| InChI | InChI=1S/C12H19BrN2/c1-8(2)6-9(3)15-12-7-10(13)4-5-11(12)14/h4-5,7-9,15H,6,14H2,1-3H3 |
| InChIKey | WENKJEKJVQYMCM-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.20 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|