C11H13BrClNO4S — CID 82910581
5-bromo-2-[2-[ethyl(methyl)amino]-2-oxoethoxy]benzenesulfonyl chloride (PubChem CID 82910581) has the molecular formula C11H13BrClNO4S and a molecular weight of 370.65 g/mol. Its IUPAC name is 5-bromo-2-[2-[ethyl(methyl)amino]-2-oxoethoxy]benzenesulfonyl chloride.
| Compound Name | 5-bromo-2-[2-[ethyl(methyl)amino]-2-oxoethoxy]benzenesulfonyl chloride |
|---|---|
| PubChem CID | 82910581 |
| Molecular Formula | C11H13BrClNO4S |
| Molecular Weight | 370.65 g/mol |
| Exact Mass | 368.94 |
| IUPAC Name | 5-bromo-2-[2-[ethyl(methyl)amino]-2-oxoethoxy]benzenesulfonyl chloride |
| SMILES | CCN(C)C(=O)COc1ccc(Br)cc1S(=O)(=O)Cl |
| InChI | InChI=1S/C11H13BrClNO4S/c1-3-14(2)11(15)7-18-9-5-4-8(12)6-10(9)19(13,16)17/h4-6H,3,7H2,1-2H3 |
| InChIKey | RCXDWYDRQXXGSI-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.65 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |