C14H18ClNO4S — CID 82911512
4-[2-(cyclopentylamino)-2-oxoethoxy]-2-methylbenzenesulfonyl chloride (PubChem CID 82911512) has the molecular formula C14H18ClNO4S and a molecular weight of 331.82 g/mol. Its IUPAC name is 4-[2-(cyclopentylamino)-2-oxoethoxy]-2-methylbenzenesulfonyl chloride.
| Compound Name | 4-[2-(cyclopentylamino)-2-oxoethoxy]-2-methylbenzenesulfonyl chloride |
|---|---|
| PubChem CID | 82911512 |
| Molecular Formula | C14H18ClNO4S |
| Molecular Weight | 331.82 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | 4-[2-(cyclopentylamino)-2-oxoethoxy]-2-methylbenzenesulfonyl chloride |
| SMILES | Cc1cc(OCC(=O)NC2CCCC2)ccc1S(=O)(=O)Cl |
| InChI | InChI=1S/C14H18ClNO4S/c1-10-8-12(6-7-13(10)21(15,18)19)20-9-14(17)16-11-4-2-3-5-11/h6-8,11H,2-5,9H2,1H3,(H,16,17) |
| InChIKey | CAGWDDWOOKRODL-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.82 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |