C9H12ClN3O3S — CID 82911791
1-[2-(cyclopropylmethylamino)-2-oxoethyl]pyrazole-4-sulfonyl chloride (PubChem CID 82911791) has the molecular formula C9H12ClN3O3S and a molecular weight of 277.73 g/mol. Its IUPAC name is 1-[2-(cyclopropylmethylamino)-2-oxoethyl]pyrazole-4-sulfonyl chloride.
| Compound Name | 1-[2-(cyclopropylmethylamino)-2-oxoethyl]pyrazole-4-sulfonyl chloride |
|---|---|
| PubChem CID | 82911791 |
| Molecular Formula | C9H12ClN3O3S |
| Molecular Weight | 277.73 g/mol |
| Exact Mass | 277.03 |
| IUPAC Name | 1-[2-(cyclopropylmethylamino)-2-oxoethyl]pyrazole-4-sulfonyl chloride |
| SMILES | O=C(Cn1cc(S(=O)(=O)Cl)cn1)NCC1CC1 |
| InChI | InChI=1S/C9H12ClN3O3S/c10-17(15,16)8-4-12-13(5-8)6-9(14)11-3-7-1-2-7/h4-5,7H,1-3,6H2,(H,11,14) |
| InChIKey | YPJZZIKBRSERAF-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.73 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |