1-(3-ethoxypropyl)pyrazole-4-sulfonyl chloride

C8H13ClN2O3S — CID 65180837

IUPAC1-(3-ethoxypropyl)pyrazole-4-sulfonyl chloride
SMILESCCOCCCn1cc(S(=O)(=O)Cl)cn1
InChIInChI=1S/C8H13ClN2O3S/c1-2-14-5-3-4-11-7-8(6-10-11)15(9,12)13/h6-7H,2-5H2,1H3
InChIKeyNNFDYLMUASSZCF-UHFFFAOYSA-N
MW252.72 g/mol
LogP1.24
Rot. Bonds6

About 1-(3-ethoxypropyl)pyrazole-4-sulfonyl chloride

1-(3-ethoxypropyl)pyrazole-4-sulfonyl chloride (PubChem CID 65180837) has the molecular formula C8H13ClN2O3S and a molecular weight of 252.72 g/mol. Its IUPAC name is 1-(3-ethoxypropyl)pyrazole-4-sulfonyl chloride.

Molecular Properties

Compound Name1-(3-ethoxypropyl)pyrazole-4-sulfonyl chloride
PubChem CID65180837
Molecular FormulaC8H13ClN2O3S
Molecular Weight252.72 g/mol
Exact Mass252.03
IUPAC Name1-(3-ethoxypropyl)pyrazole-4-sulfonyl chloride
SMILESCCOCCCn1cc(S(=O)(=O)Cl)cn1
InChIInChI=1S/C8H13ClN2O3S/c1-2-14-5-3-4-11-7-8(6-10-11)15(9,12)13/h6-7H,2-5H2,1H3
InChIKeyNNFDYLMUASSZCF-UHFFFAOYSA-N
XLogP1.24
TPSA61.19 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds6
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500252.72
LogP ≤ 51.24
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 1-(3-ethoxypropyl)pyrazole-4-sulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-(3-ethoxypropyl)pyrazole-4-sulfonyl chloride?
The IUPAC name of 1-(3-ethoxypropyl)pyrazole-4-sulfonyl chloride (CID 65180837) is 1-(3-ethoxypropyl)pyrazole-4-sulfonyl chloride.
What is the SMILES notation for 1-(3-ethoxypropyl)pyrazole-4-sulfonyl chloride?
The canonical SMILES for 1-(3-ethoxypropyl)pyrazole-4-sulfonyl chloride is CCOCCCn1cc(S(=O)(=O)Cl)cn1.
What is the InChIKey of 1-(3-ethoxypropyl)pyrazole-4-sulfonyl chloride?
The InChIKey is NNFDYLMUASSZCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13ClN2O3S/c1-2-14-5-3-4-11-7-8(6-10-11)15(9,12)13/h6-7H,2-5H2,1H3.
What are the key properties of 1-(3-ethoxypropyl)pyrazole-4-sulfonyl chloride?
1-(3-ethoxypropyl)pyrazole-4-sulfonyl chloride has a molecular weight of 252.72 g/mol, XLogP of 1.24, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-ethoxypropyl)pyrazole-4-sulfonyl chloride is sourced from PubChem (CID 65180837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).