C7H8ClN5O6S — CID 82914445
1-[1-(carbamoylamino)-1-oxopropan-2-yl]-3-nitropyrazole-4-sulfonyl chloride (PubChem CID 82914445) has the molecular formula C7H8ClN5O6S and a molecular weight of 325.69 g/mol. Its IUPAC name is 1-[1-(carbamoylamino)-1-oxopropan-2-yl]-3-nitropyrazole-4-sulfonyl chloride.
| Compound Name | 1-[1-(carbamoylamino)-1-oxopropan-2-yl]-3-nitropyrazole-4-sulfonyl chloride |
|---|---|
| PubChem CID | 82914445 |
| Molecular Formula | C7H8ClN5O6S |
| Molecular Weight | 325.69 g/mol |
| Exact Mass | 324.99 |
| IUPAC Name | 1-[1-(carbamoylamino)-1-oxopropan-2-yl]-3-nitropyrazole-4-sulfonyl chloride |
| SMILES | CC(C(=O)NC(N)=O)n1cc(S(=O)(=O)Cl)c([N+](=O)[O-])n1 |
| InChI | InChI=1S/C7H8ClN5O6S/c1-3(6(14)10-7(9)15)12-2-4(20(8,18)19)5(11-12)13(16)17/h2-3H,1H3,(H3,9,10,14,15) |
| InChIKey | OQZPZOXZFYKRPA-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 167.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.69 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|