C15H12Br2F2O2 — CID 82916368
1-bromo-5-(bromomethyl)-2-[(3,4-difluorophenyl)methoxy]-3-methoxybenzene (PubChem CID 82916368) has the molecular formula C15H12Br2F2O2 and a molecular weight of 422.06 g/mol. Its IUPAC name is 1-bromo-5-(bromomethyl)-2-[(3,4-difluorophenyl)methoxy]-3-methoxybenzene.
| Compound Name | 1-bromo-5-(bromomethyl)-2-[(3,4-difluorophenyl)methoxy]-3-methoxybenzene |
|---|---|
| PubChem CID | 82916368 |
| Molecular Formula | C15H12Br2F2O2 |
| Molecular Weight | 422.06 g/mol |
| Exact Mass | 419.92 |
| IUPAC Name | 1-bromo-5-(bromomethyl)-2-[(3,4-difluorophenyl)methoxy]-3-methoxybenzene |
| SMILES | COc1cc(CBr)cc(Br)c1OCc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C15H12Br2F2O2/c1-20-14-6-10(7-16)4-11(17)15(14)21-8-9-2-3-12(18)13(19)5-9/h2-6H,7-8H2,1H3 |
| InChIKey | SYIDTCXYSLUCFM-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.06 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|